Cost-effective and customizable 2-methoxymalonamide 5018-31-5 in stock We provide high quality 2-methoxymalonamide (CAS 5018-31-5), at a very affordable prices to our customers.

1.What is the 2-methoxymalonamide ?

2-Methoxymalonamide, also known as N-methoxymalonamide, is a chemical compound characterized by the molecular formula C4H7NO3. It is a white, crystalline solid that plays a significant role in various chemical applications, including organic synthesis and as a reagent in chemical reactions. This versatile compound is recognized for its utility as a building block in the synthesis of pharmaceuticals and agrochemicals, as well as its applications in coordination chemistry and as a stabilizer for peroxide compounds. Its potential in the medical field, particularly for treating certain diseases and disorders, is an area of ongoing research and exploration.

Used in Pharmaceutical and Agrochemical Synthesis:
2-Methoxymalonamide is utilized as a key building block for the synthesis of various pharmaceuticals and agrochemicals. Its chemical properties make it a valuable component in the development of new drugs and agricultural chemicals, contributing to advancements in healthcare and agriculture.
Used in Coordination Chemistry:
In the field of coordination chemistry, 2-Methoxymalonamide serves as a ligand, participating in the formation of coordination compounds. Its ability to bind with metal ions enhances the stability and reactivity of these compounds, broadening their applications in various chemical processes.
Used as a Stabilizer for Peroxide Compounds:
2-Methoxymalonamide is employed as a stabilizer for peroxide compounds, enhancing their stability and safety in various industrial applications. Its stabilizing effect is crucial in preventing the premature decomposition of peroxides, which can be hazardous.
Used in Medical Applications:
Although still under investigation, 2-Methoxymalonamide has shown potential in the medical field for the treatment of certain diseases and disorders. Its specific applications and effects are being studied to fully understand its potential contributions to healthcare.

2.What is the CAS number for 2-methoxymalonamide ?

The CAS number of 2-methoxymalonamide is 5018-31-5.

More information of 2-methoxymalonamide 5018-31-5 are:

3.What is the molecular formula of 2-methoxymalonamide ?

The chemical formula of?2-methoxymalonamide is C4H8 N2 O3 which containing 4 Carbon atoms,8 Hydrogen atoms,2 Nitrogen atoms and 3 Oxygen atoms,and the molecular weight, and the molecular weight of 2-methoxymalonamide is 132.119

4.What is 2-methoxymalonamide(5018-31-5)used for?

2-Methoxymalonamide, also known as N-methoxymalonamide, is a chemical compound characterized by the molecular formula C4H7NO3. It is a white, crystalline solid that plays a significant role in various chemical applications, including organic synthesis and as a reagent in chemical reactions. This versatile compound is recognized for its utility as a building block in the synthesis of pharmaceuticals and agrochemicals, as well as its applications in coordination chemistry and as a stabilizer for peroxide compounds. Its potential in the medical field, particularly for treating certain diseases and disorders, is an area of ongoing research and exploration.

InChI:InChI=1/C4H8N2O3/c1-9-2(3(5)7)4(6)8/h2H,1H3,(H2,5,7)(H2,6,8)

Relevant articles related to 2-methoxymalonamide:

5.Cost-effective and customizable 2-methoxymalonamide 5018-31-5 in stock

biochem-lab.org is a quality supplier of 2-methoxymalonamide. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 2-methoxymalonamide 5018-31-5.