What is the 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE?

1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is white to slight-yellowish fibrous crystalline powder, while it's Molecular Formula is C7H4Cl2N4S. white to slight-yellowish fibrous crystalline powder Used in Pharmaceutical Industry: 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is used as an intermediate in the synthesis of pharmaceuticals for its potential therapeutic effects on various diseases. It has been studied for its possible use in treating cancer and cardiovascular disorders due to its unique chemical structure and biological activity. Used in Agrochemical Industry: In the agrochemical sector, 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE serves as an intermediate in the production of agrochemicals, contributing to the development of new compounds with pesticidal or herbicidal properties. Used in Material Science: 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is utilized as a building block in material science for the creation of novel polymeric materials. Its incorporation into polymer structures can lead to the development of advanced materials with specific properties for various applications. Overall, 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is a versatile chemical entity with significant implications in drug discovery, agrochemical development, and materials research, making it an important molecule for further exploration and application.

What is the CAS number for 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE?

The CAS number of 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is 63684-99-1.

What is the 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE?

1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is white to slight-yellowish fibrous crystalline powder, while it's Molecular Formula is C7H4Cl2N4S. white to slight-yellowish fibrous crystalline powder Used in Pharmaceutical Industry: 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is used as an intermediate in the synthesis of pharmaceuticals for its potential therapeutic effects on various diseases. It has been studied for its possible use in treating cancer and cardiovascular disorders due to its unique chemical structure and biological activity. Used in Agrochemical Industry: In the agrochemical sector, 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE serves as an intermediate in the production of agrochemicals, contributing to the development of new compounds with pesticidal or herbicidal properties. Used in Material Science: 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is utilized as a building block in material science for the creation of novel polymeric materials. Its incorporation into polymer structures can lead to the development of advanced materials with specific properties for various applications. Overall, 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is a versatile chemical entity with significant implications in drug discovery, agrochemical development, and materials research, making it an important molecule for further exploration and application.

What is the CAS number for 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE?

The CAS number of 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is 63684-99-1.

Quality Factory Supply 99% Pure 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE 63684-99-1 with Efficient Delivery

Q: What is 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE (63684-99-1) used for?

1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is a chemical compound characterized by the molecular formula C7H4Cl2N4S. It is a tetrazole derivative featuring a substituted phenyl ring and a mercapto group, which endows it with unique chemical properties and potential applications in various fields.InChI:InChI=1/C7H4Cl2N4S/c8-5-2-1-4(3-6(5)9)13-7(14)10-11-12-13/h1-3H,(H,10,12,14)

Others

Location:Home > Product

1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE

Product Name 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE
cas 63684-99-1
purity 99%

Inquiry

Quality Factory Supply 99% Pure 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE 63684-99-1 with Efficient Delivery

Molecular Formula: C7H4Cl2N4S
Molecular Weight: 247.108
Appearance/Colour: white to slight-yellowish fibrous crystalline powder
Vapor Pressure: 9.1E-05mmHg at 25°C
Melting Point: 148-150 °C
Refractive Index: 1.787
Boiling Point: 339.6 °C at 760 mmHg
Flash Point: 159.2 °C
PSA： 82.40000
Density: 1.75 g/cm³
LogP: 2.25780

1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE(Cas 63684-99-1) Usage

General Description

1-(3,4-Dichlorophenyl)-5-mercapto-1H-tetrazole is a chemical compound with the molecular formula C7H4Cl2N4S. It is a tetrazole derivative with a substituted phenyl ring and a mercapto group. 1-(3,4-DICHLOROPHENYL)-5-MERCAPTO-1H-TETRAZOLE is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. It has been studied for its potential as a therapeutic agent for various diseases, including cancer and cardiovascular disorders. Additionally, it is also used in the field of material science as a building block for the creation of novel polymeric materials. The compound's unique chemical structure and potential applications make it an important molecule in the realm of drug discovery and materials research.

InChI:InChI=1/C7H4Cl2N4S/c8-5-2-1-4(3-6(5)9)13-7(14)10-11-12-13/h1-3H,(H,10,12,14)